5-hydroxy-3-(4-hydroxyphenyl)-7-methoxychromen-4-one
Catalog No: FT-0708556
CAS No: 552-59-0
- Chemical Name: 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxychromen-4-one
- Molecular Formula: C16H12O5
- Molecular Weight: 284.26
- InChI Key: KQMVAGISDHMXJJ-UHFFFAOYSA-N
- InChI: InChI=1S/C16H12O5/c1-20-11-6-13(18)15-14(7-11)21-8-12(16(15)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 240-242ºC |
|---|---|
| FW: | 284.263 |
| CAS: | 552-59-0 |
| MF: | C16H12O5 |
| Flash_Point: | 209.7±23.6 °C |
| Product_Name: | Prunetin |
| Bolling_Point: | 546.5±50.0 °C at 760 mmHg |
| Density: | 1.4±0.1 g/cm3 |
| Refractive_Index: | 1.669 |
|---|---|
| Vapor_Pressure: | 0.0±1.5 mmHg at 25°C |
| Flash_Point: | 209.7±23.6 °C |
| LogP: | 3.53 |
| Bolling_Point: | 546.5±50.0 °C at 760 mmHg |
| FW: | 284.263 |
| PSA: | 79.90000 |
| Melting_Point: | 240-242ºC |
| MF: | C16H12O5 |
| Exact_Mass: | 284.068481 |
| Density: | 1.4±0.1 g/cm3 |
| RTECS: | DJ3100050 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | S22-S24/25 |
| HS_Code: | 2914509090 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)